C10H13N — CID 153395011
N,N-dimethylcyclooctatetraenamine (PubChem CID 153395011) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is N,N-dimethylcyclooctatetraenamine.
| Compound Name | N,N-dimethylcyclooctatetraenamine |
|---|---|
| PubChem CID | 153395011 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | N,N-dimethylcyclooctatetraenamine |
| SMILES | CN(C)C1=C/C=C\C=C/C=C\1 |
| InChI | InChI=1S/C10H13N/c1-11(2)10-8-6-4-3-5-7-9-10/h3-9H,1-2H3/b4-3-,5-3-,6-4-,7-5-,8-6-,9-7-,10-8+,10-9+ |
| InChIKey | MBYJQJHHJDZDNF-AXMJBYMSSA-N |
| XLogP | 2.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |