C13H15N — CID 163497639
(1E,3Z,5E,7Z,9Z)-4-methyl-11-methylidenecycloundeca-1,3,5,7,9-pentaen-1-amine (PubChem CID 163497639) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is (1E,3Z,5E,7Z,9Z)-4-methyl-11-methylidenecycloundeca-1,3,5,7,9-pentaen-1-amine.
| Compound Name | (1E,3Z,5E,7Z,9Z)-4-methyl-11-methylidenecycloundeca-1,3,5,7,9-pentaen-1-amine |
|---|---|
| PubChem CID | 163497639 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (1E,3Z,5E,7Z,9Z)-4-methyl-11-methylidenecycloundeca-1,3,5,7,9-pentaen-1-amine |
| SMILES | C=C1/C=C\C=C/C=C/C(C)=C\C=C/1N |
| InChI | InChI=1S/C13H15N/c1-11-7-5-3-4-6-8-12(2)13(14)10-9-11/h3-10H,2,14H2,1H3/b4-3-,7-5+,8-6-,11-9-,13-10+ |
| InChIKey | CSBJNYYYELJYOW-HXDSNAGJSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |