4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen

C8H13N — CID 143190843

IUPAC4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen
SMILESCC1=CC=C(N)CC=C1.[H][H]
InChIInChI=1S/C8H11N.H2/c1-7-3-2-4-8(9)6-5-7;/h2-3,5-6H,4,9H2,1H3;1H
InChIKeyBVPXIDHWMBNHSO-UHFFFAOYSA-N
MW123.20 g/mol
LogP1.98
Rot. Bonds

About 4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen

4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen (PubChem CID 143190843) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen.

Molecular Properties

Compound Name4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen
PubChem CID143190843
Molecular FormulaC8H13N
Molecular Weight123.20 g/mol
Exact Mass123.10
IUPAC Name4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen
SMILESCC1=CC=C(N)CC=C1.[H][H]
InChIInChI=1S/C8H11N.H2/c1-7-3-2-4-8(9)6-5-7;/h2-3,5-6H,4,9H2,1H3;1H
InChIKeyBVPXIDHWMBNHSO-UHFFFAOYSA-N
XLogP1.98
TPSA26.02 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500123.20
LogP ≤ 51.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen?
The IUPAC name of 4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen (CID 143190843) is 4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen.
What is the SMILES notation for 4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen?
The canonical SMILES for 4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen is CC1=CC=C(N)CC=C1.[H][H].
What is the InChIKey of 4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen?
The InChIKey is BVPXIDHWMBNHSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.H2/c1-7-3-2-4-8(9)6-5-7;/h2-3,5-6H,4,9H2,1H3;1H.
What are the key properties of 4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen?
4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen has a molecular weight of 123.20 g/mol, XLogP of 1.98, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclohepta-1,3,5-trien-1-amine;molecular hydrogen is sourced from PubChem (CID 143190843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).