C11H16O — CID 171648958
4-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene (PubChem CID 171648958) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 4-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene.
| Compound Name | 4-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 171648958 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 4-methyl-1-propan-2-yloxycyclohepta-1,3,5-triene |
| SMILES | CC1=CC=C(OC(C)C)CC=C1 |
| InChI | InChI=1S/C11H16O/c1-9(2)12-11-6-4-5-10(3)7-8-11/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | PZJLNJZSZOOSDO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |