C10H15NO — CID 143275435
acetaldehyde;4-methylcyclohepta-1,3,5-trien-1-amine (PubChem CID 143275435) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is acetaldehyde;4-methylcyclohepta-1,3,5-trien-1-amine.
| Compound Name | acetaldehyde;4-methylcyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 143275435 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | acetaldehyde;4-methylcyclohepta-1,3,5-trien-1-amine |
| SMILES | CC1=CC=C(N)CC=C1.CC=O |
| InChI | InChI=1S/C8H11N.C2H4O/c1-7-3-2-4-8(9)6-5-7;1-2-3/h2-3,5-6H,4,9H2,1H3;2H,1H3 |
| InChIKey | KRGYDNMQKJTULT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|