C9H14OSi — CID 15205236
2-trimethylsilylcyclopenta-1,3-diene-1-carbaldehyde (PubChem CID 15205236) has the molecular formula C9H14OSi and a molecular weight of 166.30 g/mol. Its IUPAC name is 2-trimethylsilylcyclopenta-1,3-diene-1-carbaldehyde.
| Compound Name | 2-trimethylsilylcyclopenta-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 15205236 |
| Molecular Formula | C9H14OSi |
| Molecular Weight | 166.30 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 2-trimethylsilylcyclopenta-1,3-diene-1-carbaldehyde |
| SMILES | C[Si](C)(C)C1=C(C=O)CC=C1 |
| InChI | InChI=1S/C9H14OSi/c1-11(2,3)9-6-4-5-8(9)7-10/h4,6-7H,5H2,1-3H3 |
| InChIKey | QLWCQNISSBREIL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|