C13H11NO — CID 143193115
4-pyridin-4-ylcyclohepta-1,3,6-triene-1-carbaldehyde (PubChem CID 143193115) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-pyridin-4-ylcyclohepta-1,3,6-triene-1-carbaldehyde.
| Compound Name | 4-pyridin-4-ylcyclohepta-1,3,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 143193115 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 4-pyridin-4-ylcyclohepta-1,3,6-triene-1-carbaldehyde |
| SMILES | O=CC1=CC=C(c2ccncc2)CC=C1 |
| InChI | InChI=1S/C13H11NO/c15-10-11-2-1-3-12(5-4-11)13-6-8-14-9-7-13/h1-2,4-10H,3H2 |
| InChIKey | JFVATQFWFVAYOM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|