About 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine
4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine (PubChem CID 131994161) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine.
Molecular Properties
| Compound Name | 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine |
| PubChem CID | 131994161 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine |
| SMILES | CC1=CC=C(c2ccncc2)CN1 |
| InChI | InChI=1S/C11H12N2/c1-9-2-3-11(8-13-9)10-4-6-12-7-5-10/h2-7,13H,8H2,1H3 |
| InChIKey | JPFPISSZUUPZAS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine?
The IUPAC name of 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine (CID 131994161) is 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine.
What is the SMILES notation for 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine?
The canonical SMILES for 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine is CC1=CC=C(c2ccncc2)CN1.
What is the InChIKey of 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine?
The InChIKey is JPFPISSZUUPZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-9-2-3-11(8-13-9)10-4-6-12-7-5-10/h2-7,13H,8H2,1H3.
What are the key properties of 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine?
4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine has a molecular weight of 172.23 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-methyl-1,2-dihydropyridin-3-yl)pyridine is sourced from PubChem (CID 131994161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).