C11H12N2 — CID 121217815
4-(3,4-dimethyl-1H-pyrrol-2-yl)pyridine (PubChem CID 121217815) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-(3,4-dimethyl-1H-pyrrol-2-yl)pyridine.
| Compound Name | 4-(3,4-dimethyl-1H-pyrrol-2-yl)pyridine |
|---|---|
| PubChem CID | 121217815 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 4-(3,4-dimethyl-1H-pyrrol-2-yl)pyridine |
| SMILES | Cc1c[nH]c(-c2ccncc2)c1C |
| InChI | InChI=1S/C11H12N2/c1-8-7-13-11(9(8)2)10-3-5-12-6-4-10/h3-7,13H,1-2H3 |
| InChIKey | SVSWLLHAFWTYED-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |