C15H19NO — CID 143296781
ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde (PubChem CID 143296781) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde.
| Compound Name | ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 143296781 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde |
| SMILES | CC.O=CC1=CC=C(c2ccccn2)CC=C1.[H][H] |
| InChI | InChI=1S/C13H11NO.C2H6.H2/c15-10-11-4-3-5-12(8-7-11)13-6-1-2-9-14-13;1-2;/h1-4,6-10H,5H2;1-2H3;1H |
| InChIKey | UCSSUARFRSSRNS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|