About ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde
ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde (PubChem CID 143296781) has the molecular formula C15H19NO
and a molecular weight of 229.32 g/mol. Its IUPAC name is ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde |
| PubChem CID | 143296781 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde |
| SMILES | CC.O=CC1=CC=C(c2ccccn2)CC=C1.[H][H] |
| InChI | InChI=1S/C13H11NO.C2H6.H2/c15-10-11-4-3-5-12(8-7-11)13-6-1-2-9-14-13;1-2;/h1-4,6-10H,5H2;1-2H3;1H |
| InChIKey | UCSSUARFRSSRNS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde?
The IUPAC name of ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde (CID 143296781) is ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde.
What is the SMILES notation for ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde?
The canonical SMILES for ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde is CC.O=CC1=CC=C(c2ccccn2)CC=C1.[H][H].
What is the InChIKey of ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde?
The InChIKey is UCSSUARFRSSRNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO.C2H6.H2/c15-10-11-4-3-5-12(8-7-11)13-6-1-2-9-14-13;1-2;/h1-4,6-10H,5H2;1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde?
ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde has a molecular weight of 229.32 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;4-pyridin-2-ylcyclohepta-1,3,6-triene-1-carbaldehyde is sourced from PubChem (CID 143296781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).