C11H10ClN — CID 156543167
2-(4-chlorocyclohexa-1,3-dien-1-yl)pyridine (PubChem CID 156543167) has the molecular formula C11H10ClN and a molecular weight of 191.66 g/mol. Its IUPAC name is 2-(4-chlorocyclohexa-1,3-dien-1-yl)pyridine.
| Compound Name | 2-(4-chlorocyclohexa-1,3-dien-1-yl)pyridine |
|---|---|
| PubChem CID | 156543167 |
| Molecular Formula | C11H10ClN |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 2-(4-chlorocyclohexa-1,3-dien-1-yl)pyridine |
| SMILES | ClC1=CC=C(c2ccccn2)CC1 |
| InChI | InChI=1S/C11H10ClN/c12-10-6-4-9(5-7-10)11-3-1-2-8-13-11/h1-4,6,8H,5,7H2 |
| InChIKey | UGFZTDSVWVLXNJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |