C9H10N2 — CID 88971870
2-(2,3-dihydro-1H-pyrrol-4-yl)pyridine (PubChem CID 88971870) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-pyrrol-4-yl)pyridine.
| Compound Name | 2-(2,3-dihydro-1H-pyrrol-4-yl)pyridine |
|---|---|
| PubChem CID | 88971870 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2-(2,3-dihydro-1H-pyrrol-4-yl)pyridine |
| SMILES | C1=C(c2ccccn2)CCN1 |
| InChI | InChI=1S/C9H10N2/c1-2-5-11-9(3-1)8-4-6-10-7-8/h1-3,5,7,10H,4,6H2 |
| InChIKey | GSXRBEGKVDNKAL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |