C13H17N — CID 177335848
2-cyclohexa-1,3-dien-1-ylpyridine;ethane (PubChem CID 177335848) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-ylpyridine;ethane.
| Compound Name | 2-cyclohexa-1,3-dien-1-ylpyridine;ethane |
|---|---|
| PubChem CID | 177335848 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-ylpyridine;ethane |
| SMILES | C1=CCCC(c2ccccn2)=C1.CC |
| InChI | InChI=1S/C11H11N.C2H6/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-2/h1-2,4-6,8-9H,3,7H2;1-2H3 |
| InChIKey | PZVSRUWOFRCVAJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |