C11H14IN — CID 88585985
2-(1-methyl-3,6-dihydro-2H-1λ3-iodinin-4-yl)pyridine (PubChem CID 88585985) has the molecular formula C11H14IN and a molecular weight of 287.14 g/mol. Its IUPAC name is 2-(1-methyl-3,6-dihydro-2H-1λ3-iodinin-4-yl)pyridine.
| Compound Name | 2-(1-methyl-3,6-dihydro-2H-1λ3-iodinin-4-yl)pyridine |
|---|---|
| PubChem CID | 88585985 |
| Molecular Formula | C11H14IN |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-(1-methyl-3,6-dihydro-2H-1λ3-iodinin-4-yl)pyridine |
| SMILES | CI1CC=C(c2ccccn2)CC1 |
| InChI | InChI=1S/C11H14IN/c1-12-7-5-10(6-8-12)11-4-2-3-9-13-11/h2-5,9H,6-8H2,1H3 |
| InChIKey | KHFYGZDASKKXHR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|