C16H14N2 — CID 143485808
2-cyclohexa-1,3-dien-1-yl-6-pyridin-2-ylpyridine (PubChem CID 143485808) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-6-pyridin-2-ylpyridine.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-6-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 143485808 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-6-pyridin-2-ylpyridine |
| SMILES | C1=CCCC(c2cccc(-c3ccccn3)n2)=C1 |
| InChI | InChI=1S/C16H14N2/c1-2-7-13(8-3-1)14-10-6-11-16(18-14)15-9-4-5-12-17-15/h1-2,4-7,9-12H,3,8H2 |
| InChIKey | DFHQZKQSXWEGLT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |