C16H18N2O2 — CID 143128955
4-[2-[methyl(pyridin-2-yl)amino]ethoxy]cyclohepta-1,3,6-triene-1-carbaldehyde (PubChem CID 143128955) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-[2-[methyl(pyridin-2-yl)amino]ethoxy]cyclohepta-1,3,6-triene-1-carbaldehyde.
| Compound Name | 4-[2-[methyl(pyridin-2-yl)amino]ethoxy]cyclohepta-1,3,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 143128955 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 4-[2-[methyl(pyridin-2-yl)amino]ethoxy]cyclohepta-1,3,6-triene-1-carbaldehyde |
| SMILES | CN(CCOC1=CC=C(C=O)C=CC1)c1ccccn1 |
| InChI | InChI=1S/C16H18N2O2/c1-18(16-7-2-3-10-17-16)11-12-20-15-6-4-5-14(13-19)8-9-15/h2-5,7-10,13H,6,11-12H2,1H3 |
| InChIKey | RWTFMLKOOVOLJG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|