C15H16N2O2 — CID 46782305
4-[2-[pyridin-2-yl(trideuteriomethyl)amino]ethoxy]benzaldehyde (PubChem CID 46782305) has the molecular formula C15H16N2O2 and a molecular weight of 259.32 g/mol. Its IUPAC name is 4-[2-[pyridin-2-yl(trideuteriomethyl)amino]ethoxy]benzaldehyde.
| Compound Name | 4-[2-[pyridin-2-yl(trideuteriomethyl)amino]ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 46782305 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-[2-[pyridin-2-yl(trideuteriomethyl)amino]ethoxy]benzaldehyde |
| SMILES | [2H]C([2H])([2H])N(CCOc1ccc(C=O)cc1)c1ccccn1 |
| InChI | InChI=1S/C15H16N2O2/c1-17(15-4-2-3-9-16-15)10-11-19-14-7-5-13(12-18)6-8-14/h2-9,12H,10-11H2,1H3/i1D3 |
| InChIKey | FRMKJZNBTRONBV-FIBGUPNXSA-N |
| XLogP | 2.41 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|