C19H21N3O2S2 — CID 143214890
(Z)-N-methanethioyl-3-[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]-2-methylsulfanylprop-2-enamide (PubChem CID 143214890) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is (Z)-N-methanethioyl-3-[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]-2-methylsulfanylprop-2-enamide.
| Compound Name | (Z)-N-methanethioyl-3-[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]-2-methylsulfanylprop-2-enamide |
|---|---|
| PubChem CID | 143214890 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (Z)-N-methanethioyl-3-[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]-2-methylsulfanylprop-2-enamide |
| SMILES | CS/C(=C\c1ccc(OCCN(C)c2ccccn2)cc1)C(=O)NC=S |
| InChI | InChI=1S/C19H21N3O2S2/c1-22(18-5-3-4-10-20-18)11-12-24-16-8-6-15(7-9-16)13-17(26-2)19(23)21-14-25/h3-10,13-14H,11-12H2,1-2H3,(H,21,23,25)/b17-13- |
| InChIKey | LXZNSDQIKLYZRC-LGMDPLHJSA-N |
| XLogP | 3.37 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|