C23H30N2O4 — CID 11315503
ethyl 2-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-3-oxohexanoate (PubChem CID 11315503) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is ethyl 2-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-3-oxohexanoate.
| Compound Name | ethyl 2-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-3-oxohexanoate |
|---|---|
| PubChem CID | 11315503 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | ethyl 2-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-3-oxohexanoate |
| SMILES | CCCC(=O)C(Cc1ccc(OCCN(C)c2ccccn2)cc1)C(=O)OCC |
| InChI | InChI=1S/C23H30N2O4/c1-4-8-21(26)20(23(27)28-5-2)17-18-10-12-19(13-11-18)29-16-15-25(3)22-9-6-7-14-24-22/h6-7,9-14,20H,4-5,8,15-17H2,1-3H3 |
| InChIKey | UJEMRSAMBXXLSZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|