C12H18N2O — CID 144750049
N-(3-ethoxybut-3-enyl)-N-methylpyridin-2-amine (PubChem CID 144750049) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-(3-ethoxybut-3-enyl)-N-methylpyridin-2-amine.
| Compound Name | N-(3-ethoxybut-3-enyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 144750049 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-(3-ethoxybut-3-enyl)-N-methylpyridin-2-amine |
| SMILES | C=C(CCN(C)c1ccccn1)OCC |
| InChI | InChI=1S/C12H18N2O/c1-4-15-11(2)8-10-14(3)12-7-5-6-9-13-12/h5-7,9H,2,4,8,10H2,1,3H3 |
| InChIKey | IGVKQTBDWPGNLD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|