C28H27N3O3 — CID 70109686
3-[2-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-4-phenyl-1H-pyrrol-3-yl]prop-2-enoic acid (PubChem CID 70109686) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-[2-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-4-phenyl-1H-pyrrol-3-yl]prop-2-enoic acid.
| Compound Name | 3-[2-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-4-phenyl-1H-pyrrol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70109686 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 3-[2-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-4-phenyl-1H-pyrrol-3-yl]prop-2-enoic acid |
| SMILES | CN(CCOc1ccc(Cc2[nH]cc(-c3ccccc3)c2C=CC(=O)O)cc1)c1ccccn1 |
| InChI | InChI=1S/C28H27N3O3/c1-31(27-9-5-6-16-29-27)17-18-34-23-12-10-21(11-13-23)19-26-24(14-15-28(32)33)25(20-30-26)22-7-3-2-4-8-22/h2-16,20,30H,17-19H2,1H3,(H,32,33) |
| InChIKey | VRZKJCIJLCQQSY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|