About 4-methylcyclohepta-1,3,5-triene-1-carbonitrile
4-methylcyclohepta-1,3,5-triene-1-carbonitrile (PubChem CID 18343928) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is 4-methylcyclohepta-1,3,5-triene-1-carbonitrile.
Analyze 4-methylcyclohepta-1,3,5-triene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylcyclohepta-1,3,5-triene-1-carbonitrile?
The IUPAC name of 4-methylcyclohepta-1,3,5-triene-1-carbonitrile (CID 18343928) is 4-methylcyclohepta-1,3,5-triene-1-carbonitrile.
What is the SMILES notation for 4-methylcyclohepta-1,3,5-triene-1-carbonitrile?
The canonical SMILES for 4-methylcyclohepta-1,3,5-triene-1-carbonitrile is CC1=CC=C(C#N)CC=C1.
What is the InChIKey of 4-methylcyclohepta-1,3,5-triene-1-carbonitrile?
The InChIKey is DOSGWAMWAIVFJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N/c1-8-3-2-4-9(7-10)6-5-8/h2-3,5-6H,4H2,1H3.
What are the key properties of 4-methylcyclohepta-1,3,5-triene-1-carbonitrile?
4-methylcyclohepta-1,3,5-triene-1-carbonitrile has a molecular weight of 131.18 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclohepta-1,3,5-triene-1-carbonitrile is sourced from PubChem (CID 18343928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).