C8H8N2 — CID 143822406
4-aminocyclohepta-1,3,6-triene-1-carbonitrile (PubChem CID 143822406) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is 4-aminocyclohepta-1,3,6-triene-1-carbonitrile.
| Compound Name | 4-aminocyclohepta-1,3,6-triene-1-carbonitrile |
|---|---|
| PubChem CID | 143822406 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 4-aminocyclohepta-1,3,6-triene-1-carbonitrile |
| SMILES | N#CC1=CC=C(N)CC=C1 |
| InChI | InChI=1S/C8H8N2/c9-6-7-2-1-3-8(10)5-4-7/h1-2,4-5H,3,10H2 |
| InChIKey | DDQHEPMCKNSIJN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |