C7H10N2 — CID 145013911
cyclohepta-1,3,5-triene-1,4-diamine (PubChem CID 145013911) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is cyclohepta-1,3,5-triene-1,4-diamine.
| Compound Name | cyclohepta-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 145013911 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | cyclohepta-1,3,5-triene-1,4-diamine |
| SMILES | NC1=CC=C(N)CC=C1 |
| InChI | InChI=1S/C7H10N2/c8-6-2-1-3-7(9)5-4-6/h1-2,4-5H,3,8-9H2 |
| InChIKey | GGURNWAURSNFBU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |