C12H13N3 — CID 142181687
4-N-pyridin-4-ylcyclohepta-1,3,5-triene-1,4-diamine (PubChem CID 142181687) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 4-N-pyridin-4-ylcyclohepta-1,3,5-triene-1,4-diamine.
| Compound Name | 4-N-pyridin-4-ylcyclohepta-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 142181687 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-N-pyridin-4-ylcyclohepta-1,3,5-triene-1,4-diamine |
| SMILES | NC1=CC=C(Nc2ccncc2)C=CC1 |
| InChI | InChI=1S/C12H13N3/c13-10-2-1-3-11(5-4-10)15-12-6-8-14-9-7-12/h1,3-9H,2,13H2,(H,14,15) |
| InChIKey | XPOZBVRBKWBVCV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |