C13H15N3 — CID 115126655
4,5-dimethyl-2-N-pyridin-4-ylbenzene-1,2-diamine (PubChem CID 115126655) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 4,5-dimethyl-2-N-pyridin-4-ylbenzene-1,2-diamine.
| Compound Name | 4,5-dimethyl-2-N-pyridin-4-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115126655 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4,5-dimethyl-2-N-pyridin-4-ylbenzene-1,2-diamine |
| SMILES | Cc1cc(N)c(Nc2ccncc2)cc1C |
| InChI | InChI=1S/C13H15N3/c1-9-7-12(14)13(8-10(9)2)16-11-3-5-15-6-4-11/h3-8H,14H2,1-2H3,(H,15,16) |
| InChIKey | DVCTWNNNZNPVML-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|