C15H25NOS — CID 142308952
ethane;S-ethyl 2-[methyl-(4-methylcyclohepta-1,3,5-trien-1-yl)amino]ethanethioate (PubChem CID 142308952) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is ethane;S-ethyl 2-[methyl-(4-methylcyclohepta-1,3,5-trien-1-yl)amino]ethanethioate.
| Compound Name | ethane;S-ethyl 2-[methyl-(4-methylcyclohepta-1,3,5-trien-1-yl)amino]ethanethioate |
|---|---|
| PubChem CID | 142308952 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | ethane;S-ethyl 2-[methyl-(4-methylcyclohepta-1,3,5-trien-1-yl)amino]ethanethioate |
| SMILES | CC.CCSC(=O)CN(C)C1=CC=C(C)C=CC1 |
| InChI | InChI=1S/C13H19NOS.C2H6/c1-4-16-13(15)10-14(3)12-7-5-6-11(2)8-9-12;1-2/h5-6,8-9H,4,7,10H2,1-3H3;1-2H3 |
| InChIKey | NLHYYSOAILXEAB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|