C11H17NO — CID 143130109
N-ethyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide (PubChem CID 143130109) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-ethyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide.
| Compound Name | N-ethyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 143130109 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-ethyl-N-(4-methylcyclohexa-1,3-dien-1-yl)acetamide |
| SMILES | CCN(C(C)=O)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C11H17NO/c1-4-12(10(3)13)11-7-5-9(2)6-8-11/h5,7H,4,6,8H2,1-3H3 |
| InChIKey | UEERZBGWWHHTQN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |