C12H14BrF2NO — CID 174953014
2-bromo-1,1-difluoroethene;N-ethyl-N-phenylacetamide (PubChem CID 174953014) has the molecular formula C12H14BrF2NO and a molecular weight of 306.15 g/mol. Its IUPAC name is 2-bromo-1,1-difluoroethene;N-ethyl-N-phenylacetamide.
| Compound Name | 2-bromo-1,1-difluoroethene;N-ethyl-N-phenylacetamide |
|---|---|
| PubChem CID | 174953014 |
| Molecular Formula | C12H14BrF2NO |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 2-bromo-1,1-difluoroethene;N-ethyl-N-phenylacetamide |
| SMILES | CCN(C(C)=O)c1ccccc1.FC(F)=CBr |
| InChI | InChI=1S/C10H13NO.C2HBrF2/c1-3-11(9(2)12)10-7-5-4-6-8-10;3-1-2(4)5/h4-8H,3H2,1-2H3;1H |
| InChIKey | AMSMULPDXUCOAL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |