C17H20N2Se — CID 134917239
1,3-diethyl-1,3-diphenylselenourea (PubChem CID 134917239) has the molecular formula C17H20N2Se and a molecular weight of 331.32 g/mol. Its IUPAC name is 1,3-diethyl-1,3-diphenylselenourea.
| Compound Name | 1,3-diethyl-1,3-diphenylselenourea |
|---|---|
| PubChem CID | 134917239 |
| Molecular Formula | C17H20N2Se |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1,3-diethyl-1,3-diphenylselenourea |
| SMILES | CCN(C(=[Se])N(CC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2Se/c1-3-18(15-11-7-5-8-12-15)17(20)19(4-2)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | KPZPBZUXCZWRNW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|