C8H8O — CID 13265824
5-methyl-6-methylidenecyclohexa-2,4-dien-1-one (PubChem CID 13265824) has the molecular formula C8H8O and a molecular weight of 120.15 g/mol. Its IUPAC name is 5-methyl-6-methylidenecyclohexa-2,4-dien-1-one.
| Compound Name | 5-methyl-6-methylidenecyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 13265824 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 5-methyl-6-methylidenecyclohexa-2,4-dien-1-one |
| SMILES | C=C1C(=O)C=CC=C1C |
| InChI | InChI=1S/C8H8O/c1-6-4-3-5-8(9)7(6)2/h3-5H,2H2,1H3 |
| InChIKey | TYWMDTKUDVEYHJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|