C12H20O — CID 157497539
methane;6-methylidenecyclohexa-2,4-dien-1-one;2-methylpropane (PubChem CID 157497539) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is methane;6-methylidenecyclohexa-2,4-dien-1-one;2-methylpropane.
| Compound Name | methane;6-methylidenecyclohexa-2,4-dien-1-one;2-methylpropane |
|---|---|
| PubChem CID | 157497539 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | methane;6-methylidenecyclohexa-2,4-dien-1-one;2-methylpropane |
| SMILES | C.C=C1C=CC=CC1=O.CC(C)C |
| InChI | InChI=1S/C7H6O.C4H10.CH4/c1-6-4-2-3-5-7(6)8;1-4(2)3;/h2-5H,1H2;4H,1-3H3;1H4 |
| InChIKey | BXZXUNDHWUBWOT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|