C6H5ClO6 — CID 162153120
cyclohexa-3,5-diene-1,2-dione;perchloric acid (PubChem CID 162153120) has the molecular formula C6H5ClO6 and a molecular weight of 208.55 g/mol. Its IUPAC name is cyclohexa-3,5-diene-1,2-dione;perchloric acid.
| Compound Name | cyclohexa-3,5-diene-1,2-dione;perchloric acid |
|---|---|
| PubChem CID | 162153120 |
| Molecular Formula | C6H5ClO6 |
| Molecular Weight | 208.55 g/mol |
| Exact Mass | 207.98 |
| IUPAC Name | cyclohexa-3,5-diene-1,2-dione;perchloric acid |
| SMILES | O=C1C=CC=CC1=O.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C6H4O2.ClHO4/c7-5-3-1-2-4-6(5)8;2-1(3,4)5/h1-4H;(H,2,3,4,5) |
| InChIKey | ZLLYLZWLGSBMRY-UHFFFAOYSA-N |
| XLogP | -3.87 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.55 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|