C15H15NO4 — CID 70268504
(2S)-2-amino-3-phenylpropanoic acid;cyclohexa-3,5-diene-1,2-dione (PubChem CID 70268504) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;cyclohexa-3,5-diene-1,2-dione.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 70268504 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;cyclohexa-3,5-diene-1,2-dione |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O.O=C1C=CC=CC1=O |
| InChI | InChI=1S/C9H11NO2.C6H4O2/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-5-3-1-2-4-6(5)8/h1-5,8H,6,10H2,(H,11,12);1-4H/t8-;/m0./s1 |
| InChIKey | IVONTPZINHJONO-QRPNPIFTSA-N |
| XLogP | 0.89 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|