About cyclohexa-3,5-diene-1,2-dione;piperazine
cyclohexa-3,5-diene-1,2-dione;piperazine (PubChem CID 174374612) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is cyclohexa-3,5-diene-1,2-dione;piperazine.
Molecular Properties
| Compound Name | cyclohexa-3,5-diene-1,2-dione;piperazine |
| PubChem CID | 174374612 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | cyclohexa-3,5-diene-1,2-dione;piperazine |
| SMILES | C1CNCCN1.O=C1C=CC=CC1=O |
| InChI | InChI=1S/C6H4O2.C4H10N2/c7-5-3-1-2-4-6(5)8;1-2-6-4-3-5-1/h1-4H;5-6H,1-4H2 |
| InChIKey | PZYDDMJGICCHOQ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-3,5-diene-1,2-dione;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-3,5-diene-1,2-dione;piperazine?
The IUPAC name of cyclohexa-3,5-diene-1,2-dione;piperazine (CID 174374612) is cyclohexa-3,5-diene-1,2-dione;piperazine.
What is the SMILES notation for cyclohexa-3,5-diene-1,2-dione;piperazine?
The canonical SMILES for cyclohexa-3,5-diene-1,2-dione;piperazine is C1CNCCN1.O=C1C=CC=CC1=O.
What is the InChIKey of cyclohexa-3,5-diene-1,2-dione;piperazine?
The InChIKey is PZYDDMJGICCHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2.C4H10N2/c7-5-3-1-2-4-6(5)8;1-2-6-4-3-5-1/h1-4H;5-6H,1-4H2.
What are the key properties of cyclohexa-3,5-diene-1,2-dione;piperazine?
cyclohexa-3,5-diene-1,2-dione;piperazine has a molecular weight of 194.23 g/mol, XLogP of -0.57, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-3,5-diene-1,2-dione;piperazine is sourced from PubChem (CID 174374612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).