C7H6Se — CID 14249672
6-methylidenecyclohexa-2,4-diene-1-selone (PubChem CID 14249672) has the molecular formula C7H6Se and a molecular weight of 169.08 g/mol. Its IUPAC name is 6-methylidenecyclohexa-2,4-diene-1-selone.
| Compound Name | 6-methylidenecyclohexa-2,4-diene-1-selone |
|---|---|
| PubChem CID | 14249672 |
| Molecular Formula | C7H6Se |
| Molecular Weight | 169.08 g/mol |
| Exact Mass | 169.96 |
| IUPAC Name | 6-methylidenecyclohexa-2,4-diene-1-selone |
| SMILES | C=C1C=CC=CC1=[Se] |
| InChI | InChI=1S/C7H6Se/c1-6-4-2-3-5-7(6)8/h2-5H,1H2 |
| InChIKey | UXOODAQTDOJJDL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.08 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|