C20H20 — CID 90931509
(4Z,7Z,10Z,13Z)-3,6,9,12,15-pentamethylidenecyclopentadeca-1,4,7,10,13-pentaene (PubChem CID 90931509) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z)-3,6,9,12,15-pentamethylidenecyclopentadeca-1,4,7,10,13-pentaene.
| Compound Name | (4Z,7Z,10Z,13Z)-3,6,9,12,15-pentamethylidenecyclopentadeca-1,4,7,10,13-pentaene |
|---|---|
| PubChem CID | 90931509 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (4Z,7Z,10Z,13Z)-3,6,9,12,15-pentamethylidenecyclopentadeca-1,4,7,10,13-pentaene |
| SMILES | C=C1C=CC(=C)/C=C/C(=C)/C=C\C(=C)/C=C\C(=C)/C=C\1 |
| InChI | InChI=1S/C20H20/c1-16-6-8-17(2)10-12-19(4)14-15-20(5)13-11-18(3)9-7-16/h6-15H,1-5H2/b8-6-,9-7-,12-10-,13-11-,15-14? |
| InChIKey | DNRHLNIWPNHVLQ-SHBYFXOWSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |