About methane;2-methyl-5-methylidenecyclopenta-1,3-diene
methane;2-methyl-5-methylidenecyclopenta-1,3-diene (PubChem CID 142180985) has the molecular formula C9H16
and a molecular weight of 124.23 g/mol. Its IUPAC name is methane;2-methyl-5-methylidenecyclopenta-1,3-diene.
Analyze methane;2-methyl-5-methylidenecyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methyl-5-methylidenecyclopenta-1,3-diene?
The IUPAC name of methane;2-methyl-5-methylidenecyclopenta-1,3-diene (CID 142180985) is methane;2-methyl-5-methylidenecyclopenta-1,3-diene.
What is the SMILES notation for methane;2-methyl-5-methylidenecyclopenta-1,3-diene?
The canonical SMILES for methane;2-methyl-5-methylidenecyclopenta-1,3-diene is C.C.C=C1C=CC(C)=C1.
What is the InChIKey of methane;2-methyl-5-methylidenecyclopenta-1,3-diene?
The InChIKey is WDXFAAPZDKPIGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.2CH4/c1-6-3-4-7(2)5-6;;/h3-5H,1H2,2H3;2*1H4.
What are the key properties of methane;2-methyl-5-methylidenecyclopenta-1,3-diene?
methane;2-methyl-5-methylidenecyclopenta-1,3-diene has a molecular weight of 124.23 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methyl-5-methylidenecyclopenta-1,3-diene is sourced from PubChem (CID 142180985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).