C11H13N — CID 142851442
3-methyl-6-methylidene-N-[(Z)-prop-1-enyl]cyclohexa-2,4-dien-1-imine (PubChem CID 142851442) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-methyl-6-methylidene-N-[(Z)-prop-1-enyl]cyclohexa-2,4-dien-1-imine.
| Compound Name | 3-methyl-6-methylidene-N-[(Z)-prop-1-enyl]cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142851442 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 3-methyl-6-methylidene-N-[(Z)-prop-1-enyl]cyclohexa-2,4-dien-1-imine |
| SMILES | C=C1C=CC(C)=C/C1=N\C=C/C |
| InChI | InChI=1S/C11H13N/c1-4-7-12-11-8-9(2)5-6-10(11)3/h4-8H,3H2,1-2H3/b7-4-,12-11+ |
| InChIKey | GNNFMMWDCOFEJF-OFBTUZCMSA-N |
| XLogP | 3.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|