About acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine
acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine (PubChem CID 143379896) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine.
Molecular Properties
| Compound Name | acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine |
| PubChem CID | 143379896 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine |
| SMILES | C#C.C=NC1=C(C)CC(=C)/C1=N\C=C/C |
| InChI | InChI=1S/C11H14N2.C2H2/c1-5-6-13-11-9(3)7-8(2)10(11)12-4;1-2/h5-6H,3-4,7H2,1-2H3;1-2H/b6-5-,13-11+; |
| InChIKey | KIAHIGVBBOWYFF-IXPPWOGASA-N |
| XLogP | 3.14 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine?
The IUPAC name of acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine (CID 143379896) is acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine.
What is the SMILES notation for acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine?
The canonical SMILES for acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine is C#C.C=NC1=C(C)CC(=C)/C1=N\C=C/C.
What is the InChIKey of acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine?
The InChIKey is KIAHIGVBBOWYFF-IXPPWOGASA-N. The full InChI is InChI=1S/C11H14N2.C2H2/c1-5-6-13-11-9(3)7-8(2)10(11)12-4;1-2/h5-6H,3-4,7H2,1-2H3;1-2H/b6-5-,13-11+;.
What are the key properties of acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine?
acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine has a molecular weight of 200.28 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;3-methyl-5-methylidene-2-(methylideneamino)-N-[(Z)-prop-1-enyl]cyclopent-2-en-1-imine is sourced from PubChem (CID 143379896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).