C7H10 — CID 20600458
1,2-dimethyl-3-methylidenecyclobutene (PubChem CID 20600458) has the molecular formula C7H10 and a molecular weight of 94.16 g/mol. Its IUPAC name is 1,2-dimethyl-3-methylidenecyclobutene.
| Compound Name | 1,2-dimethyl-3-methylidenecyclobutene |
|---|---|
| PubChem CID | 20600458 |
| Molecular Formula | C7H10 |
| Molecular Weight | 94.16 g/mol |
| Exact Mass | 94.08 |
| IUPAC Name | 1,2-dimethyl-3-methylidenecyclobutene |
| SMILES | C=C1CC(C)=C1C |
| InChI | InChI=1S/C7H10/c1-5-4-6(2)7(5)3/h1,4H2,2-3H3 |
| InChIKey | PQVYKXWXBBYUJA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 94.16 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |