About 3,4-dimethyl-5-methylidene-1,2-dihydropyrrole
3,4-dimethyl-5-methylidene-1,2-dihydropyrrole (PubChem CID 143599482) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is 3,4-dimethyl-5-methylidene-1,2-dihydropyrrole.
Analyze 3,4-dimethyl-5-methylidene-1,2-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-5-methylidene-1,2-dihydropyrrole?
The IUPAC name of 3,4-dimethyl-5-methylidene-1,2-dihydropyrrole (CID 143599482) is 3,4-dimethyl-5-methylidene-1,2-dihydropyrrole.
What is the SMILES notation for 3,4-dimethyl-5-methylidene-1,2-dihydropyrrole?
The canonical SMILES for 3,4-dimethyl-5-methylidene-1,2-dihydropyrrole is C=C1NCC(C)=C1C.
What is the InChIKey of 3,4-dimethyl-5-methylidene-1,2-dihydropyrrole?
The InChIKey is YWIHONJYHWHIAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N/c1-5-4-8-7(3)6(5)2/h8H,3-4H2,1-2H3.
What are the key properties of 3,4-dimethyl-5-methylidene-1,2-dihydropyrrole?
3,4-dimethyl-5-methylidene-1,2-dihydropyrrole has a molecular weight of 109.17 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-5-methylidene-1,2-dihydropyrrole is sourced from PubChem (CID 143599482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).