C7H16NP — CID 144939825
3,4-dimethyl-2,5-dihydro-1H-pyrrole;methylphosphane (PubChem CID 144939825) has the molecular formula C7H16NP and a molecular weight of 145.19 g/mol. Its IUPAC name is 3,4-dimethyl-2,5-dihydro-1H-pyrrole;methylphosphane.
| Compound Name | 3,4-dimethyl-2,5-dihydro-1H-pyrrole;methylphosphane |
|---|---|
| PubChem CID | 144939825 |
| Molecular Formula | C7H16NP |
| Molecular Weight | 145.19 g/mol |
| Exact Mass | 145.10 |
| IUPAC Name | 3,4-dimethyl-2,5-dihydro-1H-pyrrole;methylphosphane |
| SMILES | CC1=C(C)CNC1.CP |
| InChI | InChI=1S/C6H11N.CH5P/c1-5-3-7-4-6(5)2;1-2/h7H,3-4H2,1-2H3;2H2,1H3 |
| InChIKey | VVKBPAPULICHJZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|