C7H12ClN — CID 123543135
2-chloro-4,5-dimethyl-1,2,3,6-tetrahydropyridine (PubChem CID 123543135) has the molecular formula C7H12ClN and a molecular weight of 145.63 g/mol. Its IUPAC name is 2-chloro-4,5-dimethyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 2-chloro-4,5-dimethyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 123543135 |
| Molecular Formula | C7H12ClN |
| Molecular Weight | 145.63 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2-chloro-4,5-dimethyl-1,2,3,6-tetrahydropyridine |
| SMILES | CC1=C(C)CC(Cl)NC1 |
| InChI | InChI=1S/C7H12ClN/c1-5-3-7(8)9-4-6(5)2/h7,9H,3-4H2,1-2H3 |
| InChIKey | OUWYYUUHJUZJAY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.63 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|