C8H14OS — CID 130131216
2,5,6-trimethyl-3,4-dihydro-2H-thiopyran-3-ol (PubChem CID 130131216) has the molecular formula C8H14OS and a molecular weight of 158.27 g/mol. Its IUPAC name is 2,5,6-trimethyl-3,4-dihydro-2H-thiopyran-3-ol.
| Compound Name | 2,5,6-trimethyl-3,4-dihydro-2H-thiopyran-3-ol |
|---|---|
| PubChem CID | 130131216 |
| Molecular Formula | C8H14OS |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 2,5,6-trimethyl-3,4-dihydro-2H-thiopyran-3-ol |
| SMILES | CC1=C(C)SC(C)C(O)C1 |
| InChI | InChI=1S/C8H14OS/c1-5-4-8(9)7(3)10-6(5)2/h7-9H,4H2,1-3H3 |
| InChIKey | PZLJBEYICKZWGP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |