C7H10O4 — CID 78200843
2,5,6-trihydroxy-3-methylcyclohex-2-en-1-one (PubChem CID 78200843) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is 2,5,6-trihydroxy-3-methylcyclohex-2-en-1-one.
| Compound Name | 2,5,6-trihydroxy-3-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 78200843 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 2,5,6-trihydroxy-3-methylcyclohex-2-en-1-one |
| SMILES | CC1=C(O)C(=O)C(O)C(O)C1 |
| InChI | InChI=1S/C7H10O4/c1-3-2-4(8)6(10)7(11)5(3)9/h4,6,8-10H,2H2,1H3 |
| InChIKey | DPONTXUDLAFZOP-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |