C7H10O5 — CID 101411204
3,4,5,6-tetrahydroxy-2-methylcyclohex-2-en-1-one (PubChem CID 101411204) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is 3,4,5,6-tetrahydroxy-2-methylcyclohex-2-en-1-one.
| Compound Name | 3,4,5,6-tetrahydroxy-2-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 101411204 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 3,4,5,6-tetrahydroxy-2-methylcyclohex-2-en-1-one |
| SMILES | CC1=C(O)C(O)C(O)C(O)C1=O |
| InChI | InChI=1S/C7H10O5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h5-8,10-12H,1H3 |
| InChIKey | KUMBPQQUJPNQLZ-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |