C8H12OS — CID 14046238
2,5,6-trimethyl-4H-thiopyran-3-one (PubChem CID 14046238) has the molecular formula C8H12OS and a molecular weight of 156.25 g/mol. Its IUPAC name is 2,5,6-trimethyl-4H-thiopyran-3-one.
| Compound Name | 2,5,6-trimethyl-4H-thiopyran-3-one |
|---|---|
| PubChem CID | 14046238 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2,5,6-trimethyl-4H-thiopyran-3-one |
| SMILES | CC1=C(C)SC(C)C(=O)C1 |
| InChI | InChI=1S/C8H12OS/c1-5-4-8(9)7(3)10-6(5)2/h7H,4H2,1-3H3 |
| InChIKey | ODRGMIRGVOWIEX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |