C6H10OS2 — CID 91750211
(3S,6S)-3,6-dimethyldithian-4-one (PubChem CID 91750211) has the molecular formula C6H10OS2 and a molecular weight of 162.28 g/mol. Its IUPAC name is (3S,6S)-3,6-dimethyldithian-4-one.
| Compound Name | (3S,6S)-3,6-dimethyldithian-4-one |
|---|---|
| PubChem CID | 91750211 |
| Molecular Formula | C6H10OS2 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | (3S,6S)-3,6-dimethyldithian-4-one |
| SMILES | C[C@@H]1SS[C@@H](C)CC1=O |
| InChI | InChI=1S/C6H10OS2/c1-4-3-6(7)5(2)9-8-4/h4-5H,3H2,1-2H3/t4-,5-/m0/s1 |
| InChIKey | AIYPIRMRRSFZEP-WHFBIAKZSA-N |
| XLogP | 2.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|