C5H6O3S — CID 171383827
3-methyl-1,4-oxathiane-2,5-dione (PubChem CID 171383827) has the molecular formula C5H6O3S and a molecular weight of 146.17 g/mol. Its IUPAC name is 3-methyl-1,4-oxathiane-2,5-dione.
| Compound Name | 3-methyl-1,4-oxathiane-2,5-dione |
|---|---|
| PubChem CID | 171383827 |
| Molecular Formula | C5H6O3S |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 3-methyl-1,4-oxathiane-2,5-dione |
| SMILES | CC1SC(=O)COC1=O |
| InChI | InChI=1S/C5H6O3S/c1-3-5(7)8-2-4(6)9-3/h3H,2H2,1H3 |
| InChIKey | YXDMDWAQWVKYKK-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|